C22H26N2O3S — CID 71727950
ethyl (1R,2R,3'R,4'R)-6-cyano-3'-ethyl-1-isothiocyanato-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate (PubChem CID 71727950) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is ethyl (1R,2R,3'R,4'R)-6-cyano-3'-ethyl-1-isothiocyanato-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate.
| Compound Name | ethyl (1R,2R,3'R,4'R)-6-cyano-3'-ethyl-1-isothiocyanato-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
|---|---|
| PubChem CID | 71727950 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | ethyl (1R,2R,3'R,4'R)-6-cyano-3'-ethyl-1-isothiocyanato-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(N=C=S)c2cc(C#N)ccc2C[C@]12CC[C@@H](OC)[C@H](CC)C2 |
| InChI | InChI=1S/C22H26N2O3S/c1-4-16-11-21(9-8-19(16)26-3)12-17-7-6-15(13-23)10-18(17)22(21,24-14-28)20(25)27-5-2/h6-7,10,16,19H,4-5,8-9,11-12H2,1-3H3/t16-,19-,21-,22-/m1/s1 |
| InChIKey | AASWEMYYRUPUBD-JCXROGDPSA-N |
| XLogP | 4.19 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|