C22H26N2O3S — CID 71728085
ethyl (1R,3'R,5'S)-6-cyano-1-isothiocyanato-4'-methoxy-3',5'-dimethylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate (PubChem CID 71728085) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is ethyl (1R,3'R,5'S)-6-cyano-1-isothiocyanato-4'-methoxy-3',5'-dimethylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate.
| Compound Name | ethyl (1R,3'R,5'S)-6-cyano-1-isothiocyanato-4'-methoxy-3',5'-dimethylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
|---|---|
| PubChem CID | 71728085 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | ethyl (1R,3'R,5'S)-6-cyano-1-isothiocyanato-4'-methoxy-3',5'-dimethylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(N=C=S)c2cc(C#N)ccc2CC12C[C@@H](C)C(OC)[C@@H](C)C2 |
| InChI | InChI=1S/C22H26N2O3S/c1-5-27-20(25)22(24-13-28)18-8-16(12-23)6-7-17(18)11-21(22)9-14(2)19(26-4)15(3)10-21/h6-8,14-15,19H,5,9-11H2,1-4H3/t14-,15+,19?,21?,22-/m1/s1 |
| InChIKey | CQAKITDEGOSSCN-ZCZBDMSKSA-N |
| XLogP | 4.04 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|