C9H8O4S — CID 71728128
7-methoxy-1,2λ6-benzoxathiine 2,2-dioxide (PubChem CID 71728128) has the molecular formula C9H8O4S and a molecular weight of 212.23 g/mol. Its IUPAC name is 7-methoxy-1,2λ6-benzoxathiine 2,2-dioxide.
| Compound Name | 7-methoxy-1,2λ6-benzoxathiine 2,2-dioxide |
|---|---|
| PubChem CID | 71728128 |
| Molecular Formula | C9H8O4S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 7-methoxy-1,2λ6-benzoxathiine 2,2-dioxide |
| SMILES | COc1ccc2c(c1)OS(=O)(=O)C=C2 |
| InChI | InChI=1S/C9H8O4S/c1-12-8-3-2-7-4-5-14(10,11)13-9(7)6-8/h2-6H,1H3 |
| InChIKey | FJVKKCZTNRYTJJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|