C23H24N2O4 — CID 71728224
(5R)-5-benzyl-N-cyclobutyl-2,4-dioxo-3-[(1R)-1-phenylethyl]-1,3-oxazolidine-5-carboxamide (PubChem CID 71728224) has the molecular formula C23H24N2O4 and a molecular weight of 392.45 g/mol. Its IUPAC name is (5R)-5-benzyl-N-cyclobutyl-2,4-dioxo-3-[(1R)-1-phenylethyl]-1,3-oxazolidine-5-carboxamide.
| Compound Name | (5R)-5-benzyl-N-cyclobutyl-2,4-dioxo-3-[(1R)-1-phenylethyl]-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 71728224 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (5R)-5-benzyl-N-cyclobutyl-2,4-dioxo-3-[(1R)-1-phenylethyl]-1,3-oxazolidine-5-carboxamide |
| SMILES | C[C@H](c1ccccc1)N1C(=O)O[C@](Cc2ccccc2)(C(=O)NC2CCC2)C1=O |
| InChI | InChI=1S/C23H24N2O4/c1-16(18-11-6-3-7-12-18)25-21(27)23(29-22(25)28,15-17-9-4-2-5-10-17)20(26)24-19-13-8-14-19/h2-7,9-12,16,19H,8,13-15H2,1H3,(H,24,26)/t16-,23-/m1/s1 |
| InChIKey | ZIEYJUHTAYIPSJ-WAIKUNEKSA-N |
| XLogP | 3.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|