About (2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine
(2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine (PubChem CID 71728303) has the molecular formula C21H20N2O2
and a molecular weight of 332.40 g/mol. Its IUPAC name is (2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine.
Molecular Properties
| Compound Name | (2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine |
| PubChem CID | 71728303 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine |
| SMILES | N[C@@H](COc1ccc2c(c1)OCc1cnccc1-2)Cc1ccccc1 |
| InChI | InChI=1S/C21H20N2O2/c22-17(10-15-4-2-1-3-5-15)14-24-18-6-7-20-19-8-9-23-12-16(19)13-25-21(20)11-18/h1-9,11-12,17H,10,13-14,22H2/t17-/m1/s1 |
| InChIKey | BLJRGKGBUVZYAP-QGZVFWFLSA-N |
| XLogP | 3.59 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine?
The IUPAC name of (2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine (CID 71728303) is (2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine.
What is the SMILES notation for (2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine?
The canonical SMILES for (2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine is N[C@@H](COc1ccc2c(c1)OCc1cnccc1-2)Cc1ccccc1.
What is the InChIKey of (2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine?
The InChIKey is BLJRGKGBUVZYAP-QGZVFWFLSA-N. The full InChI is InChI=1S/C21H20N2O2/c22-17(10-15-4-2-1-3-5-15)14-24-18-6-7-20-19-8-9-23-12-16(19)13-25-21(20)11-18/h1-9,11-12,17H,10,13-14,22H2/t17-/m1/s1.
What are the key properties of (2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine?
(2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine has a molecular weight of 332.40 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(5H-chromeno[3,4-c]pyridin-8-yloxy)-3-phenylpropan-2-amine is sourced from PubChem (CID 71728303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).