C11H16F3NO3 — CID 71729095
ethyl (E,4S)-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enoate (PubChem CID 71729095) has the molecular formula C11H16F3NO3 and a molecular weight of 267.25 g/mol. Its IUPAC name is ethyl (E,4S)-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enoate.
| Compound Name | ethyl (E,4S)-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enoate |
|---|---|
| PubChem CID | 71729095 |
| Molecular Formula | C11H16F3NO3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | ethyl (E,4S)-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enoate |
| SMILES | CCC[C@@H](/C=C/C(=O)OCC)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO3/c1-3-5-8(6-7-9(16)18-4-2)15-10(17)11(12,13)14/h6-8H,3-5H2,1-2H3,(H,15,17)/b7-6+/t8-/m0/s1 |
| InChIKey | MDGIKLUPNMEQOM-CZEYKFRCSA-N |
| XLogP | 1.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|