C12H18F3NO3 — CID 71729099
ethyl (E,4S)-6-methyl-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enoate (PubChem CID 71729099) has the molecular formula C12H18F3NO3 and a molecular weight of 281.27 g/mol. Its IUPAC name is ethyl (E,4S)-6-methyl-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enoate.
| Compound Name | ethyl (E,4S)-6-methyl-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enoate |
|---|---|
| PubChem CID | 71729099 |
| Molecular Formula | C12H18F3NO3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | ethyl (E,4S)-6-methyl-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CC(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H18F3NO3/c1-4-19-10(17)6-5-9(7-8(2)3)16-11(18)12(13,14)15/h5-6,8-9H,4,7H2,1-3H3,(H,16,18)/b6-5+/t9-/m1/s1 |
| InChIKey | SFESXXXJZDHIED-VUHVRTRXSA-N |
| XLogP | 2.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|