C12H16F3NO5 — CID 71729100
1-O-ethyl 7-O-methyl (E,4R)-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enedioate (PubChem CID 71729100) has the molecular formula C12H16F3NO5 and a molecular weight of 311.26 g/mol. Its IUPAC name is 1-O-ethyl 7-O-methyl (E,4R)-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enedioate.
| Compound Name | 1-O-ethyl 7-O-methyl (E,4R)-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enedioate |
|---|---|
| PubChem CID | 71729100 |
| Molecular Formula | C12H16F3NO5 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-O-ethyl 7-O-methyl (E,4R)-4-[(2,2,2-trifluoroacetyl)amino]hept-2-enedioate |
| SMILES | CCOC(=O)/C=C/[C@@H](CCC(=O)OC)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO5/c1-3-21-10(18)7-5-8(4-6-9(17)20-2)16-11(19)12(13,14)15/h5,7-8H,3-4,6H2,1-2H3,(H,16,19)/b7-5+/t8-/m1/s1 |
| InChIKey | NKHKHZCEVQMNOD-WVXIBAHESA-N |
| XLogP | 1.11 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|