C13H16F3NO3 — CID 71729104
ethyl (E,4S)-4-[(2,2,2-trifluoroacetyl)amino]non-2-en-8-ynoate (PubChem CID 71729104) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is ethyl (E,4S)-4-[(2,2,2-trifluoroacetyl)amino]non-2-en-8-ynoate.
| Compound Name | ethyl (E,4S)-4-[(2,2,2-trifluoroacetyl)amino]non-2-en-8-ynoate |
|---|---|
| PubChem CID | 71729104 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | ethyl (E,4S)-4-[(2,2,2-trifluoroacetyl)amino]non-2-en-8-ynoate |
| SMILES | C#CCCC[C@@H](/C=C/C(=O)OCC)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO3/c1-3-5-6-7-10(8-9-11(18)20-4-2)17-12(19)13(14,15)16/h1,8-10H,4-7H2,2H3,(H,17,19)/b9-8+/t10-/m0/s1 |
| InChIKey | NSQHLWVYYSPGKJ-DDXVTDLHSA-N |
| XLogP | 1.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|