About 1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine]
1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine] (PubChem CID 71729113) has the molecular formula C20H19F3N2O2S
and a molecular weight of 408.45 g/mol. Its IUPAC name is 1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine].
Molecular Properties
| Compound Name | 1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine] |
| PubChem CID | 71729113 |
| Molecular Formula | C20H19F3N2O2S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine] |
| SMILES | C=C1N(S(=O)(=O)C(F)(F)F)CCC12CN(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C20H19F3N2O2S/c1-15-19(11-12-25(15)28(26,27)20(21,22)23)14-24(13-16-7-3-2-4-8-16)18-10-6-5-9-17(18)19/h2-10H,1,11-14H2 |
| InChIKey | KHZMQMUGUSWBGR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine]?
The IUPAC name of 1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine] (CID 71729113) is 1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine].
What is the SMILES notation for 1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine]?
The canonical SMILES for 1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine] is C=C1N(S(=O)(=O)C(F)(F)F)CCC12CN(Cc1ccccc1)c1ccccc12.
What is the InChIKey of 1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine]?
The InChIKey is KHZMQMUGUSWBGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F3N2O2S/c1-15-19(11-12-25(15)28(26,27)20(21,22)23)14-24(13-16-7-3-2-4-8-16)18-10-6-5-9-17(18)19/h2-10H,1,11-14H2.
What are the key properties of 1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine]?
1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine] has a molecular weight of 408.45 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2'-methylidene-1'-(trifluoromethylsulfonyl)spiro[2H-indole-3,3'-pyrrolidine] is sourced from PubChem (CID 71729113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).