About 2-butyl-3-ethoxyindazole
2-butyl-3-ethoxyindazole (PubChem CID 71729143) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-butyl-3-ethoxyindazole.
Molecular Properties
| Compound Name | 2-butyl-3-ethoxyindazole |
| PubChem CID | 71729143 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-butyl-3-ethoxyindazole |
| SMILES | CCCCn1nc2ccccc2c1OCC |
| InChI | InChI=1S/C13H18N2O/c1-3-5-10-15-13(16-4-2)11-8-6-7-9-12(11)14-15/h6-9H,3-5,10H2,1-2H3 |
| InChIKey | AGMFBUXZQLNLJF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-3-ethoxyindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3-ethoxyindazole?
The IUPAC name of 2-butyl-3-ethoxyindazole (CID 71729143) is 2-butyl-3-ethoxyindazole.
What is the SMILES notation for 2-butyl-3-ethoxyindazole?
The canonical SMILES for 2-butyl-3-ethoxyindazole is CCCCn1nc2ccccc2c1OCC.
What is the InChIKey of 2-butyl-3-ethoxyindazole?
The InChIKey is AGMFBUXZQLNLJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c1-3-5-10-15-13(16-4-2)11-8-6-7-9-12(11)14-15/h6-9H,3-5,10H2,1-2H3.
What are the key properties of 2-butyl-3-ethoxyindazole?
2-butyl-3-ethoxyindazole has a molecular weight of 218.30 g/mol, XLogP of 3.24, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3-ethoxyindazole is sourced from PubChem (CID 71729143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).