About 2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline
2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline (PubChem CID 71729474) has the molecular formula C20H11F3N2
and a molecular weight of 336.32 g/mol. Its IUPAC name is 2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline.
Molecular Properties
| Compound Name | 2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline |
| PubChem CID | 71729474 |
| Molecular Formula | C20H11F3N2 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline |
| SMILES | Fc1cc(F)c(-c2nc3ccccc3nc2-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C20H11F3N2/c21-13-10-14(22)18(15(23)11-13)20-19(12-6-2-1-3-7-12)24-16-8-4-5-9-17(16)25-20/h1-11H |
| InChIKey | WJMHQAVKJKBIJH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline?
The IUPAC name of 2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline (CID 71729474) is 2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline.
What is the SMILES notation for 2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline?
The canonical SMILES for 2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline is Fc1cc(F)c(-c2nc3ccccc3nc2-c2ccccc2)c(F)c1.
What is the InChIKey of 2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline?
The InChIKey is WJMHQAVKJKBIJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11F3N2/c21-13-10-14(22)18(15(23)11-13)20-19(12-6-2-1-3-7-12)24-16-8-4-5-9-17(16)25-20/h1-11H.
What are the key properties of 2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline?
2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline has a molecular weight of 336.32 g/mol, XLogP of 5.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3-(2,4,6-trifluorophenyl)quinoxaline is sourced from PubChem (CID 71729474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).