C23H24N4O3 — CID 71729629
2-benzyl-1-methyl-N-(3,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridin-6-amine (PubChem CID 71729629) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-benzyl-1-methyl-N-(3,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridin-6-amine.
| Compound Name | 2-benzyl-1-methyl-N-(3,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridin-6-amine |
|---|---|
| PubChem CID | 71729629 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-benzyl-1-methyl-N-(3,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridin-6-amine |
| SMILES | COc1cc(Nc2cc3c(cn2)nc(Cc2ccccc2)n3C)cc(OC)c1OC |
| InChI | InChI=1S/C23H24N4O3/c1-27-18-13-21(25-16-11-19(28-2)23(30-4)20(12-16)29-3)24-14-17(18)26-22(27)10-15-8-6-5-7-9-15/h5-9,11-14H,10H2,1-4H3,(H,24,25) |
| InChIKey | HCSHZHHXIWGKBM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |