About 1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone
1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone (PubChem CID 71729793) has the molecular formula C19H23NO3
and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone |
| PubChem CID | 71729793 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone |
| SMILES | CC(=O)c1c2c(cc3c(N(C)C)cccc13)CC(CO)(CO)C2 |
| InChI | InChI=1S/C19H23NO3/c1-12(23)18-14-5-4-6-17(20(2)3)15(14)7-13-8-19(10-21,11-22)9-16(13)18/h4-7,21-22H,8-11H2,1-3H3 |
| InChIKey | CQZLRXOQCODCOG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone?
The IUPAC name of 1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone (CID 71729793) is 1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone.
What is the SMILES notation for 1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone?
The canonical SMILES for 1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone is CC(=O)c1c2c(cc3c(N(C)C)cccc13)CC(CO)(CO)C2.
What is the InChIKey of 1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone?
The InChIKey is CQZLRXOQCODCOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO3/c1-12(23)18-14-5-4-6-17(20(2)3)15(14)7-13-8-19(10-21,11-22)9-16(13)18/h4-7,21-22H,8-11H2,1-3H3.
What are the key properties of 1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone?
1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone has a molecular weight of 313.40 g/mol, XLogP of 2.18, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(dimethylamino)-2,2-bis(hydroxymethyl)-1,3-dihydrocyclopenta[b]naphthalen-9-yl]ethanone is sourced from PubChem (CID 71729793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).