C18H13Cl2F3N4O — CID 71729804
2,6-dichloro-4-[4-methyl-6-oxido-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazol-6-ium-1-yl]aniline (PubChem CID 71729804) has the molecular formula C18H13Cl2F3N4O and a molecular weight of 429.23 g/mol. Its IUPAC name is 2,6-dichloro-4-[4-methyl-6-oxido-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazol-6-ium-1-yl]aniline.
| Compound Name | 2,6-dichloro-4-[4-methyl-6-oxido-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazol-6-ium-1-yl]aniline |
|---|---|
| PubChem CID | 71729804 |
| Molecular Formula | C18H13Cl2F3N4O |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 2,6-dichloro-4-[4-methyl-6-oxido-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazol-6-ium-1-yl]aniline |
| SMILES | CC1CN=C(c2cc(Cl)c(N)c(Cl)c2)c2c3ccc(C(F)(F)F)cc3[n+]([O-])n21 |
| InChI | InChI=1S/C18H13Cl2F3N4O/c1-8-7-25-16(9-4-12(19)15(24)13(20)5-9)17-11-3-2-10(18(21,22)23)6-14(11)27(28)26(8)17/h2-6,8H,7,24H2,1H3 |
| InChIKey | CYLVPGBVJPPVJS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|