C20H22N2O6S — CID 71729934
methyl (1S,9R,10R,11R)-10-(hydroxymethyl)-12-(3-methylphenyl)sulfonyl-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate (PubChem CID 71729934) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is methyl (1S,9R,10R,11R)-10-(hydroxymethyl)-12-(3-methylphenyl)sulfonyl-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate.
| Compound Name | methyl (1S,9R,10R,11R)-10-(hydroxymethyl)-12-(3-methylphenyl)sulfonyl-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate |
|---|---|
| PubChem CID | 71729934 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | methyl (1S,9R,10R,11R)-10-(hydroxymethyl)-12-(3-methylphenyl)sulfonyl-6-oxo-7,12-diazatricyclo[7.2.1.02,7]dodeca-2,4-diene-11-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](CO)[C@@H]2Cn3c(cccc3=O)[C@H]1N2S(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C20H22N2O6S/c1-12-5-3-6-13(9-12)29(26,27)22-16-10-21-15(7-4-8-17(21)24)19(22)18(14(16)11-23)20(25)28-2/h3-9,14,16,18-19,23H,10-11H2,1-2H3/t14-,16-,18+,19+/m0/s1 |
| InChIKey | UUXQUVVULKRINE-IAAVTCLWSA-N |
| XLogP | 0.68 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |