C14H18O6 — CID 71730001
dimethyl (1R,2R,5S)-5-methyl-7-oxo-2-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate (PubChem CID 71730001) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is dimethyl (1R,2R,5S)-5-methyl-7-oxo-2-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate.
| Compound Name | dimethyl (1R,2R,5S)-5-methyl-7-oxo-2-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 71730001 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | dimethyl (1R,2R,5S)-5-methyl-7-oxo-2-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate |
| SMILES | C/C=C/[C@@H]1[C@H]2C(=O)O[C@@]2(C)CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C14H18O6/c1-5-6-8-9-10(15)20-13(9,2)7-14(8,11(16)18-3)12(17)19-4/h5-6,8-9H,7H2,1-4H3/b6-5+/t8-,9+,13+/m1/s1 |
| InChIKey | KGDIIVWYBVIGDU-KXUGGWFVSA-N |
| XLogP | 0.85 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|