C32H34O10 — CID 71730020
6-O,6-O'-dibenzyl 5-O,8-O-diethyl (1R,4R,5R,8S)-3-oxo-2-oxatricyclo[6.3.0.01,4]undecane-5,6,6,8-tetracarboxylate (PubChem CID 71730020) has the molecular formula C32H34O10 and a molecular weight of 578.61 g/mol. Its IUPAC name is 6-O,6-O'-dibenzyl 5-O,8-O-diethyl (1R,4R,5R,8S)-3-oxo-2-oxatricyclo[6.3.0.01,4]undecane-5,6,6,8-tetracarboxylate.
| Compound Name | 6-O,6-O'-dibenzyl 5-O,8-O-diethyl (1R,4R,5R,8S)-3-oxo-2-oxatricyclo[6.3.0.01,4]undecane-5,6,6,8-tetracarboxylate |
|---|---|
| PubChem CID | 71730020 |
| Molecular Formula | C32H34O10 |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 6-O,6-O'-dibenzyl 5-O,8-O-diethyl (1R,4R,5R,8S)-3-oxo-2-oxatricyclo[6.3.0.01,4]undecane-5,6,6,8-tetracarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C(=O)O[C@]23CCC[C@]3(C(=O)OCC)CC1(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H34O10/c1-3-38-25(33)23-24-26(34)42-32(24)17-11-16-30(32,27(35)39-4-2)20-31(23,28(36)40-18-21-12-7-5-8-13-21)29(37)41-19-22-14-9-6-10-15-22/h5-10,12-15,23-24H,3-4,11,16-20H2,1-2H3/t23-,24-,30+,32+/m0/s1 |
| InChIKey | CZNFDVOLXHWWHX-QRIPFXQDSA-N |
| XLogP | 3.69 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|