C18H16F3N5O — CID 71730368
2-[2-methyl-3-(2,2,2-trifluoroethylamino)quinoxalin-5-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 71730368) has the molecular formula C18H16F3N5O and a molecular weight of 375.35 g/mol. Its IUPAC name is 2-[2-methyl-3-(2,2,2-trifluoroethylamino)quinoxalin-5-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-[2-methyl-3-(2,2,2-trifluoroethylamino)quinoxalin-5-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 71730368 |
| Molecular Formula | C18H16F3N5O |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-[2-methyl-3-(2,2,2-trifluoroethylamino)quinoxalin-5-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | Cc1nc2cccc(-c3cc4c([nH]3)CCNC4=O)c2nc1NCC(F)(F)F |
| InChI | InChI=1S/C18H16F3N5O/c1-9-16(23-8-18(19,20)21)26-15-10(3-2-4-13(15)24-9)14-7-11-12(25-14)5-6-22-17(11)27/h2-4,7,25H,5-6,8H2,1H3,(H,22,27)(H,23,26) |
| InChIKey | DTQJEAKNKGKTFD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |