C12H14ClFO5 — CID 71730536
(2R,3S,4R,5S,6R)-2-(3-chloro-2-fluorophenyl)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71730536) has the molecular formula C12H14ClFO5 and a molecular weight of 292.69 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-2-(3-chloro-2-fluorophenyl)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S,6R)-2-(3-chloro-2-fluorophenyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71730536 |
| Molecular Formula | C12H14ClFO5 |
| Molecular Weight | 292.69 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | (2R,3S,4R,5S,6R)-2-(3-chloro-2-fluorophenyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](c2cccc(Cl)c2F)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H14ClFO5/c13-6-3-1-2-5(8(6)14)12-11(18)10(17)9(16)7(4-15)19-12/h1-3,7,9-12,15-18H,4H2/t7-,9-,10+,11+,12-/m1/s1 |
| InChIKey | KKHYTULPNAEAKD-AZOIZPIDSA-N |
| XLogP | -0.01 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.69 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |