C20H26N2O4 — CID 71730830
methyl (1R,9S,13S,14R,15S)-14-(aminomethyl)-5-methoxy-15-methyl-11-oxo-10-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2(7),3,5-triene-9-carboxylate (PubChem CID 71730830) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is methyl (1R,9S,13S,14R,15S)-14-(aminomethyl)-5-methoxy-15-methyl-11-oxo-10-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2(7),3,5-triene-9-carboxylate.
| Compound Name | methyl (1R,9S,13S,14R,15S)-14-(aminomethyl)-5-methoxy-15-methyl-11-oxo-10-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2(7),3,5-triene-9-carboxylate |
|---|---|
| PubChem CID | 71730830 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | methyl (1R,9S,13S,14R,15S)-14-(aminomethyl)-5-methoxy-15-methyl-11-oxo-10-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2(7),3,5-triene-9-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2cc(OC)ccc2[C@@]23C[C@H](C)[C@@H](CN)[C@@H]2CC(=O)N13 |
| InChI | InChI=1S/C20H26N2O4/c1-11-9-20-15-5-4-13(25-2)6-12(15)7-17(19(24)26-3)22(20)18(23)8-16(20)14(11)10-21/h4-6,11,14,16-17H,7-10,21H2,1-3H3/t11-,14+,16-,17-,20-/m0/s1 |
| InChIKey | LYHGBBPRAFIMKM-BGRTYJHDSA-N |
| XLogP | 1.45 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |