C20H26N2O3 — CID 71731083
(1R,14S,15R,16S)-5-methoxy-N,16-dimethyl-12-oxo-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-triene-15-carboxamide (PubChem CID 71731083) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is (1R,14S,15R,16S)-5-methoxy-N,16-dimethyl-12-oxo-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-triene-15-carboxamide.
| Compound Name | (1R,14S,15R,16S)-5-methoxy-N,16-dimethyl-12-oxo-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-triene-15-carboxamide |
|---|---|
| PubChem CID | 71731083 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (1R,14S,15R,16S)-5-methoxy-N,16-dimethyl-12-oxo-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-triene-15-carboxamide |
| SMILES | CNC(=O)[C@@H]1[C@@H](C)C[C@@]23c4ccc(OC)cc4CCCN2C(=O)C[C@@H]13 |
| InChI | InChI=1S/C20H26N2O3/c1-12-11-20-15-7-6-14(25-3)9-13(15)5-4-8-22(20)17(23)10-16(20)18(12)19(24)21-2/h6-7,9,12,16,18H,4-5,8,10-11H2,1-3H3,(H,21,24)/t12-,16-,18+,20-/m0/s1 |
| InChIKey | MRYZJHCRROZCDJ-NWTRHVOFSA-N |
| XLogP | 2.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |