C23H32N2O3 — CID 71731084
(1R,14S,15R,16S)-N,N-diethyl-5-methoxy-16-methyl-12-oxo-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-triene-15-carboxamide (PubChem CID 71731084) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is (1R,14S,15R,16S)-N,N-diethyl-5-methoxy-16-methyl-12-oxo-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-triene-15-carboxamide.
| Compound Name | (1R,14S,15R,16S)-N,N-diethyl-5-methoxy-16-methyl-12-oxo-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-triene-15-carboxamide |
|---|---|
| PubChem CID | 71731084 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (1R,14S,15R,16S)-N,N-diethyl-5-methoxy-16-methyl-12-oxo-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-triene-15-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1[C@@H](C)C[C@@]23c4ccc(OC)cc4CCCN2C(=O)C[C@@H]13 |
| InChI | InChI=1S/C23H32N2O3/c1-5-24(6-2)22(27)21-15(3)14-23-18-10-9-17(28-4)12-16(18)8-7-11-25(23)20(26)13-19(21)23/h9-10,12,15,19,21H,5-8,11,13-14H2,1-4H3/t15-,19-,21+,23-/m0/s1 |
| InChIKey | ZHPYSTCNWRWXHD-HFBFHVOCSA-N |
| XLogP | 3.21 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |