C26H36N2O5 — CID 71731208
methyl (2S)-2-[[(1R,14S,15R,16S)-5-methoxy-16-methyl-12-oxo-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-triene-15-carbonyl]amino]-4-methylpentanoate (PubChem CID 71731208) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is methyl (2S)-2-[[(1R,14S,15R,16S)-5-methoxy-16-methyl-12-oxo-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-triene-15-carbonyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(1R,14S,15R,16S)-5-methoxy-16-methyl-12-oxo-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-triene-15-carbonyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 71731208 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | methyl (2S)-2-[[(1R,14S,15R,16S)-5-methoxy-16-methyl-12-oxo-11-azatetracyclo[9.6.0.01,14.02,7]heptadeca-2(7),3,5-triene-15-carbonyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)[C@@H]1[C@@H](C)C[C@@]23c4ccc(OC)cc4CCCN2C(=O)C[C@@H]13 |
| InChI | InChI=1S/C26H36N2O5/c1-15(2)11-21(25(31)33-5)27-24(30)23-16(3)14-26-19-9-8-18(32-4)12-17(19)7-6-10-28(26)22(29)13-20(23)26/h8-9,12,15-16,20-21,23H,6-7,10-11,13-14H2,1-5H3,(H,27,30)/t16-,20-,21-,23+,26-/m0/s1 |
| InChIKey | DFQCILCTDATPFZ-WXKZCRHYSA-N |
| XLogP | 3.05 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |