C31H35N7O3 — CID 71731982
N-[3-[4-amino-6-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-4-tert-butylbenzamide (PubChem CID 71731982) has the molecular formula C31H35N7O3 and a molecular weight of 553.67 g/mol. Its IUPAC name is N-[3-[4-amino-6-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-4-tert-butylbenzamide.
| Compound Name | N-[3-[4-amino-6-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 71731982 |
| Molecular Formula | C31H35N7O3 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | N-[3-[4-amino-6-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(-c3nc(N)nc(Nc4ccc(N5CCOCC5)cc4)n3)c2CO)cc1 |
| InChI | InChI=1S/C31H35N7O3/c1-31(2,3)21-9-7-20(8-10-21)28(40)34-26-6-4-5-24(25(26)19-39)27-35-29(32)37-30(36-27)33-22-11-13-23(14-12-22)38-15-17-41-18-16-38/h4-14,39H,15-19H2,1-3H3,(H,34,40)(H3,32,33,35,36,37) |
| InChIKey | GPRAKYUDBHGNRD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 138.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|