C20H21FN4O2 — CID 71732097
15-fluoro-3-methyl-11,19-dioxa-3,4,22-triazatetracyclo[18.3.1.02,6.012,17]tetracosa-1(24),2(6),4,12(17),13,15,20,22-octaen-21-amine (PubChem CID 71732097) has the molecular formula C20H21FN4O2 and a molecular weight of 368.41 g/mol. Its IUPAC name is 15-fluoro-3-methyl-11,19-dioxa-3,4,22-triazatetracyclo[18.3.1.02,6.012,17]tetracosa-1(24),2(6),4,12(17),13,15,20,22-octaen-21-amine.
| Compound Name | 15-fluoro-3-methyl-11,19-dioxa-3,4,22-triazatetracyclo[18.3.1.02,6.012,17]tetracosa-1(24),2(6),4,12(17),13,15,20,22-octaen-21-amine |
|---|---|
| PubChem CID | 71732097 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 15-fluoro-3-methyl-11,19-dioxa-3,4,22-triazatetracyclo[18.3.1.02,6.012,17]tetracosa-1(24),2(6),4,12(17),13,15,20,22-octaen-21-amine |
| SMILES | Cn1ncc2c1-c1cnc(N)c(c1)OCc1cc(F)ccc1OCCCC2 |
| InChI | InChI=1S/C20H21FN4O2/c1-25-19-13(11-24-25)4-2-3-7-26-17-6-5-16(21)8-15(17)12-27-18-9-14(19)10-23-20(18)22/h5-6,8-11H,2-4,7,12H2,1H3,(H2,22,23) |
| InChIKey | XZDITQKBHNRUDE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|