C27H28N6O3 — CID 71732115
N-[3-[4-amino-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-4-tert-butylbenzamide (PubChem CID 71732115) has the molecular formula C27H28N6O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[3-[4-amino-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-4-tert-butylbenzamide.
| Compound Name | N-[3-[4-amino-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 71732115 |
| Molecular Formula | C27H28N6O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | N-[3-[4-amino-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]-2-(hydroxymethyl)phenyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(-c3nc(N)nc(Nc4ccc(O)cc4)n3)c2CO)cc1 |
| InChI | InChI=1S/C27H28N6O3/c1-27(2,3)17-9-7-16(8-10-17)24(36)30-22-6-4-5-20(21(22)15-34)23-31-25(28)33-26(32-23)29-18-11-13-19(35)14-12-18/h4-14,34-35H,15H2,1-3H3,(H,30,36)(H3,28,29,31,32,33) |
| InChIKey | LADYBHKGCBDBOJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|