About ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate
ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate (PubChem CID 71732168) has the molecular formula C16H16ClNO3
and a molecular weight of 305.76 g/mol. Its IUPAC name is ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate |
| PubChem CID | 71732168 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C)c2cc(Cl)ccc2N2C(=O)CCC12 |
| InChI | InChI=1S/C16H16ClNO3/c1-3-21-16(20)15-9(2)11-8-10(17)4-5-12(11)18-13(15)6-7-14(18)19/h4-5,8,13H,3,6-7H2,1-2H3 |
| InChIKey | ONSRCDMOZDWRKA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate?
The IUPAC name of ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate (CID 71732168) is ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate.
What is the SMILES notation for ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate?
The canonical SMILES for ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate is CCOC(=O)C1=C(C)c2cc(Cl)ccc2N2C(=O)CCC12.
What is the InChIKey of ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate?
The InChIKey is ONSRCDMOZDWRKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClNO3/c1-3-21-16(20)15-9(2)11-8-10(17)4-5-12(11)18-13(15)6-7-14(18)19/h4-5,8,13H,3,6-7H2,1-2H3.
What are the key properties of ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate?
ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate has a molecular weight of 305.76 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-chloro-5-methyl-1-oxo-3,3a-dihydro-2H-pyrrolo[1,2-a]quinoline-4-carboxylate is sourced from PubChem (CID 71732168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).