C18H22O7 — CID 71732275
tert-butyl (1R,5R,6S,7R)-3'-methyl-5',8-dioxospiro[3,11-dioxatricyclo[5.3.1.01,5]undecane-6,2'-furan]-7-carboxylate (PubChem CID 71732275) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is tert-butyl (1R,5R,6S,7R)-3'-methyl-5',8-dioxospiro[3,11-dioxatricyclo[5.3.1.01,5]undecane-6,2'-furan]-7-carboxylate.
| Compound Name | tert-butyl (1R,5R,6S,7R)-3'-methyl-5',8-dioxospiro[3,11-dioxatricyclo[5.3.1.01,5]undecane-6,2'-furan]-7-carboxylate |
|---|---|
| PubChem CID | 71732275 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | tert-butyl (1R,5R,6S,7R)-3'-methyl-5',8-dioxospiro[3,11-dioxatricyclo[5.3.1.01,5]undecane-6,2'-furan]-7-carboxylate |
| SMILES | CC1=CC(=O)O[C@@]12[C@@H]1COC[C@@]13CCC(=O)[C@]2(C(=O)OC(C)(C)C)O3 |
| InChI | InChI=1S/C18H22O7/c1-10-7-13(20)23-17(10)11-8-22-9-16(11)6-5-12(19)18(17,25-16)14(21)24-15(2,3)4/h7,11H,5-6,8-9H2,1-4H3/t11-,16+,17-,18-/m1/s1 |
| InChIKey | KHTBQCOUUKPGAE-JZDMUPLMSA-N |
| XLogP | 1.09 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|