About CID 71732410
CID 71732410 (PubChem CID 71732410) has the molecular formula C15H7Br2N2O2
and a molecular weight of 407.04 g/mol.
Molecular Properties
| Compound Name | CID 71732410 |
| PubChem CID | 71732410 |
| Molecular Formula | C15H7Br2N2O2 |
| Molecular Weight | 407.04 g/mol |
| Exact Mass | 404.89 |
| IUPAC Name | — |
| SMILES | Brc1ccc(C2=NN=C(c3ccc(Br)o3)[C]3[CH][CH][CH][C]32)o1 |
| InChI | InChI=1S/C15H7Br2N2O2/c16-12-6-4-10(20-12)14-8-2-1-3-9(8)15(19-18-14)11-5-7-13(17)21-11/h1-7H |
| InChIKey | JZENTJYQAANUJK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 51.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.04 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 71732410 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71732410?
The IUPAC name of CID 71732410 (CID 71732410) is not available.
What is the SMILES notation for CID 71732410?
The canonical SMILES for CID 71732410 is Brc1ccc(C2=NN=C(c3ccc(Br)o3)[C]3[CH][CH][CH][C]32)o1.
What is the InChIKey of CID 71732410?
The InChIKey is JZENTJYQAANUJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7Br2N2O2/c16-12-6-4-10(20-12)14-8-2-1-3-9(8)15(19-18-14)11-5-7-13(17)21-11/h1-7H.
What are the key properties of CID 71732410?
CID 71732410 has a molecular weight of 407.04 g/mol, XLogP of 4.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71732410 is sourced from PubChem (CID 71732410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).