C18H14F8N2O4 — CID 71732470
(2S,3R,4S,5R)-2-[4-(4-fluorophenyl)-6-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidin-2-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 71732470) has the molecular formula C18H14F8N2O4 and a molecular weight of 474.30 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[4-(4-fluorophenyl)-6-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidin-2-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-[4-(4-fluorophenyl)-6-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidin-2-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 71732470 |
| Molecular Formula | C18H14F8N2O4 |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | (2S,3R,4S,5R)-2-[4-(4-fluorophenyl)-6-(1,1,2,2,3,3,3-heptafluoropropyl)pyrimidin-2-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](c2nc(-c3ccc(F)cc3)cc(C(F)(F)C(F)(F)C(F)(F)F)n2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H14F8N2O4/c19-8-3-1-7(2-4-8)9-5-11(16(20,21)17(22,23)18(24,25)26)28-15(27-9)14-13(31)12(30)10(6-29)32-14/h1-5,10,12-14,29-31H,6H2/t10-,12-,13-,14-/m1/s1 |
| InChIKey | RUIYRUNZXRNQLG-FMKGYKFTSA-N |
| XLogP | 2.73 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|