C32H55BrO8 — CID 71732484
[(1S,3R,6S,8S,11R,14R)-6-[(2R)-4-[(2S,3S,6R)-6-bromo-3-hydroxy-3,7,7-trimethyloxepan-2-yl]-2-hydroxybutan-2-yl]-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-14-yl] acetate (PubChem CID 71732484) has the molecular formula C32H55BrO8 and a molecular weight of 647.69 g/mol. Its IUPAC name is [(1S,3R,6S,8S,11R,14R)-6-[(2R)-4-[(2S,3S,6R)-6-bromo-3-hydroxy-3,7,7-trimethyloxepan-2-yl]-2-hydroxybutan-2-yl]-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-14-yl] acetate.
| Compound Name | [(1S,3R,6S,8S,11R,14R)-6-[(2R)-4-[(2S,3S,6R)-6-bromo-3-hydroxy-3,7,7-trimethyloxepan-2-yl]-2-hydroxybutan-2-yl]-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-14-yl] acetate |
|---|---|
| PubChem CID | 71732484 |
| Molecular Formula | C32H55BrO8 |
| Molecular Weight | 647.69 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | [(1S,3R,6S,8S,11R,14R)-6-[(2R)-4-[(2S,3S,6R)-6-bromo-3-hydroxy-3,7,7-trimethyloxepan-2-yl]-2-hydroxybutan-2-yl]-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-14-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)O[C@@H]3CC[C@@H]([C@](C)(O)CC[C@@H]4OC(C)(C)[C@H](Br)CC[C@]4(C)O)O[C@@]3(C)CC[C@H]2OC1(C)C |
| InChI | InChI=1S/C32H55BrO8/c1-20(34)37-22-14-18-32(9)26(39-28(22,4)5)15-19-31(8)25(41-32)11-10-23(40-31)30(7,36)17-13-24-29(6,35)16-12-21(33)27(2,3)38-24/h21-26,35-36H,10-19H2,1-9H3/t21-,22-,23+,24+,25-,26-,29+,30-,31+,32+/m1/s1 |
| InChIKey | FSGNEAJXLTZMHR-RVFSLCPFSA-N |
| XLogP | 5.75 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.69 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|