C28H18F3N3 — CID 71732503
17-methyl-8,14-diphenyl-12-(trifluoromethyl)-9,15,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene (PubChem CID 71732503) has the molecular formula C28H18F3N3 and a molecular weight of 453.47 g/mol. Its IUPAC name is 17-methyl-8,14-diphenyl-12-(trifluoromethyl)-9,15,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene.
| Compound Name | 17-methyl-8,14-diphenyl-12-(trifluoromethyl)-9,15,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 71732503 |
| Molecular Formula | C28H18F3N3 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 17-methyl-8,14-diphenyl-12-(trifluoromethyl)-9,15,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
| SMILES | Cn1c2nc(-c3ccccc3)cc(C(F)(F)F)c2c2nc(-c3ccccc3)c3ccccc3c21 |
| InChI | InChI=1S/C28H18F3N3/c1-34-26-20-15-9-8-14-19(20)24(18-12-6-3-7-13-18)33-25(26)23-21(28(29,30)31)16-22(32-27(23)34)17-10-4-2-5-11-17/h2-16H,1H3 |
| InChIKey | VLUFXCXJHURRIN-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |