C29H20F3N3 — CID 71732506
17-ethyl-8,14-diphenyl-12-(trifluoromethyl)-9,15,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene (PubChem CID 71732506) has the molecular formula C29H20F3N3 and a molecular weight of 467.49 g/mol. Its IUPAC name is 17-ethyl-8,14-diphenyl-12-(trifluoromethyl)-9,15,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene.
| Compound Name | 17-ethyl-8,14-diphenyl-12-(trifluoromethyl)-9,15,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 71732506 |
| Molecular Formula | C29H20F3N3 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 17-ethyl-8,14-diphenyl-12-(trifluoromethyl)-9,15,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
| SMILES | CCn1c2nc(-c3ccccc3)cc(C(F)(F)F)c2c2nc(-c3ccccc3)c3ccccc3c21 |
| InChI | InChI=1S/C29H20F3N3/c1-2-35-27-21-16-10-9-15-20(21)25(19-13-7-4-8-14-19)34-26(27)24-22(29(30,31)32)17-23(33-28(24)35)18-11-5-3-6-12-18/h3-17H,2H2,1H3 |
| InChIKey | UMYRRQVALHDDGC-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |