C12H9N3S3 — CID 71732508
4,9,14-trimethyl-3,8,15-trithia-5,10,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,13-hexaene (PubChem CID 71732508) has the molecular formula C12H9N3S3 and a molecular weight of 291.43 g/mol. Its IUPAC name is 4,9,14-trimethyl-3,8,15-trithia-5,10,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,13-hexaene.
| Compound Name | 4,9,14-trimethyl-3,8,15-trithia-5,10,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 71732508 |
| Molecular Formula | C12H9N3S3 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 4,9,14-trimethyl-3,8,15-trithia-5,10,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,13-hexaene |
| SMILES | Cc1nc2c3nc(C)sc3c3sc(C)nc3c2s1 |
| InChI | InChI=1S/C12H9N3S3/c1-4-13-7-8-11(17-5(2)14-8)12-9(10(7)16-4)15-6(3)18-12/h1-3H3 |
| InChIKey | IMGHAIBCMMHVDX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |