C24H18ClNO4 — CID 71732729
4-[(2R,3S)-3-(2-chlorophenyl)-3,4-dihydro-2H-1,4-benzoxazin-2-yl]-6-methoxychromen-2-one (PubChem CID 71732729) has the molecular formula C24H18ClNO4 and a molecular weight of 419.86 g/mol. Its IUPAC name is 4-[(2R,3S)-3-(2-chlorophenyl)-3,4-dihydro-2H-1,4-benzoxazin-2-yl]-6-methoxychromen-2-one.
| Compound Name | 4-[(2R,3S)-3-(2-chlorophenyl)-3,4-dihydro-2H-1,4-benzoxazin-2-yl]-6-methoxychromen-2-one |
|---|---|
| PubChem CID | 71732729 |
| Molecular Formula | C24H18ClNO4 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 4-[(2R,3S)-3-(2-chlorophenyl)-3,4-dihydro-2H-1,4-benzoxazin-2-yl]-6-methoxychromen-2-one |
| SMILES | COc1ccc2oc(=O)cc([C@H]3Oc4ccccc4N[C@H]3c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C24H18ClNO4/c1-28-14-10-11-20-16(12-14)17(13-22(27)29-20)24-23(15-6-2-3-7-18(15)25)26-19-8-4-5-9-21(19)30-24/h2-13,23-24,26H,1H3/t23-,24+/m0/s1 |
| InChIKey | YXKQXQHRJVMYBF-BJKOFHAPSA-N |
| XLogP | 5.74 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|