C19H20ClF3N4 — CID 71732746
(2R)-4-[4-(3-methylphenyl)triazol-1-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine;hydrochloride (PubChem CID 71732746) has the molecular formula C19H20ClF3N4 and a molecular weight of 396.84 g/mol. Its IUPAC name is (2R)-4-[4-(3-methylphenyl)triazol-1-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine;hydrochloride.
| Compound Name | (2R)-4-[4-(3-methylphenyl)triazol-1-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71732746 |
| Molecular Formula | C19H20ClF3N4 |
| Molecular Weight | 396.84 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | (2R)-4-[4-(3-methylphenyl)triazol-1-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine;hydrochloride |
| SMILES | Cc1cccc(-c2cn(CC[C@H](N)Cc3cc(F)c(F)cc3F)nn2)c1.Cl |
| InChI | InChI=1S/C19H19F3N4.ClH/c1-12-3-2-4-13(7-12)19-11-26(25-24-19)6-5-15(23)8-14-9-17(21)18(22)10-16(14)20;/h2-4,7,9-11,15H,5-6,8,23H2,1H3;1H/t15-;/m0./s1 |
| InChIKey | YOAFQNQAIFJHQA-RSAXXLAASA-N |
| XLogP | 4.05 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.84 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|