C23H19Br2NO — CID 71732800
2,4-bis(4-bromophenyl)-7,7-dimethyl-6,8-dihydroquinolin-5-one (PubChem CID 71732800) has the molecular formula C23H19Br2NO and a molecular weight of 485.22 g/mol. Its IUPAC name is 2,4-bis(4-bromophenyl)-7,7-dimethyl-6,8-dihydroquinolin-5-one.
| Compound Name | 2,4-bis(4-bromophenyl)-7,7-dimethyl-6,8-dihydroquinolin-5-one |
|---|---|
| PubChem CID | 71732800 |
| Molecular Formula | C23H19Br2NO |
| Molecular Weight | 485.22 g/mol |
| Exact Mass | 482.98 |
| IUPAC Name | 2,4-bis(4-bromophenyl)-7,7-dimethyl-6,8-dihydroquinolin-5-one |
| SMILES | CC1(C)CC(=O)c2c(-c3ccc(Br)cc3)cc(-c3ccc(Br)cc3)nc2C1 |
| InChI | InChI=1S/C23H19Br2NO/c1-23(2)12-20-22(21(27)13-23)18(14-3-7-16(24)8-4-14)11-19(26-20)15-5-9-17(25)10-6-15/h3-11H,12-13H2,1-2H3 |
| InChIKey | OJAOVGXMYJSPES-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.22 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |