C16H34O4Si — CID 71733103
(3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4-methylhept-6-en-1-ol (PubChem CID 71733103) has the molecular formula C16H34O4Si and a molecular weight of 318.53 g/mol. Its IUPAC name is (3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4-methylhept-6-en-1-ol.
| Compound Name | (3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4-methylhept-6-en-1-ol |
|---|---|
| PubChem CID | 71733103 |
| Molecular Formula | C16H34O4Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4-methylhept-6-en-1-ol |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](CCO)OCOC |
| InChI | InChI=1S/C16H34O4Si/c1-9-14(20-21(7,8)16(3,4)5)13(2)15(10-11-17)19-12-18-6/h9,13-15,17H,1,10-12H2,2-8H3/t13-,14-,15-/m0/s1 |
| InChIKey | TZXUISIEMMWBMW-KKUMJFAQSA-N |
| XLogP | 3.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|