About methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate
methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate (PubChem CID 71733225) has the molecular formula C18H28O5
and a molecular weight of 324.42 g/mol. Its IUPAC name is methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate.
Molecular Properties
| Compound Name | methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate |
| PubChem CID | 71733225 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate |
| SMILES | COC(=O)CCC1(OO)C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C18H28O5/c1-16(2,3)12-10-18(23-21,9-8-14(19)22-7)11-13(15(12)20)17(4,5)6/h10-11,21H,8-9H2,1-7H3 |
| InChIKey | BZZSUGROYAAETG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate?
The IUPAC name of methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate (CID 71733225) is methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate.
What is the SMILES notation for methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate?
The canonical SMILES for methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate is COC(=O)CCC1(OO)C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1.
What is the InChIKey of methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate?
The InChIKey is BZZSUGROYAAETG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O5/c1-16(2,3)12-10-18(23-21,9-8-14(19)22-7)11-13(15(12)20)17(4,5)6/h10-11,21H,8-9H2,1-7H3.
What are the key properties of methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate?
methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate has a molecular weight of 324.42 g/mol, XLogP of 3.70, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,5-ditert-butyl-1-hydroperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate is sourced from PubChem (CID 71733225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).