About 3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride
3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride (PubChem CID 71733475) has the molecular formula C9H12Cl2N4O
and a molecular weight of 263.13 g/mol. Its IUPAC name is 3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride.
Molecular Properties
| Compound Name | 3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride |
| PubChem CID | 71733475 |
| Molecular Formula | C9H12Cl2N4O |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride |
| SMILES | Cl.Cl.NCCC(=O)c1cnc2ncccn12 |
| InChI | InChI=1S/C9H10N4O.2ClH/c10-3-2-8(14)7-6-12-9-11-4-1-5-13(7)9;;/h1,4-6H,2-3,10H2;2*1H |
| InChIKey | KWXMORFXALFXQB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride?
The IUPAC name of 3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride (CID 71733475) is 3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride.
What is the SMILES notation for 3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride?
The canonical SMILES for 3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride is Cl.Cl.NCCC(=O)c1cnc2ncccn12.
What is the InChIKey of 3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride?
The InChIKey is KWXMORFXALFXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O.2ClH/c10-3-2-8(14)7-6-12-9-11-4-1-5-13(7)9;;/h1,4-6H,2-3,10H2;2*1H.
What are the key properties of 3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride?
3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride has a molecular weight of 263.13 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-imidazo[1,2-a]pyrimidin-3-ylpropan-1-one;dihydrochloride is sourced from PubChem (CID 71733475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).