C34H40N2O4 — CID 71733623
6-[[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 71733623) has the molecular formula C34H40N2O4 and a molecular weight of 540.70 g/mol. Its IUPAC name is 6-[[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 71733623 |
| Molecular Formula | C34H40N2O4 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | 6-[[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | C[C@]12CC[C@H](OC(=O)C3CC=CCC3C(=O)O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(n3cnc4ccccc43)=CC[C@@H]12 |
| InChI | InChI=1S/C34H40N2O4/c1-33-17-15-22(40-32(39)24-8-4-3-7-23(24)31(37)38)19-21(33)11-12-25-26-13-14-30(34(26,2)18-16-27(25)33)36-20-35-28-9-5-6-10-29(28)36/h3-6,9-11,14,20,22-27H,7-8,12-13,15-19H2,1-2H3,(H,37,38)/t22-,23?,24?,25-,26-,27-,33-,34-/m0/s1 |
| InChIKey | JHTFVLNGWJTJBI-NYIXPVKMSA-N |
| XLogP | 7.03 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|