C31H36N4O2 — CID 71733626
[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylimidazole-1-carboxylate (PubChem CID 71733626) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylimidazole-1-carboxylate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylimidazole-1-carboxylate |
|---|---|
| PubChem CID | 71733626 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylimidazole-1-carboxylate |
| SMILES | Cc1nccn1C(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(n4cnc5ccccc54)=CC[C@@H]32)C1 |
| InChI | InChI=1S/C31H36N4O2/c1-20-32-16-17-34(20)29(36)37-22-12-14-30(2)21(18-22)8-9-23-24-10-11-28(31(24,3)15-13-25(23)30)35-19-33-26-6-4-5-7-27(26)35/h4-8,11,16-17,19,22-25H,9-10,12-15,18H2,1-3H3/t22-,23-,24-,25-,30-,31-/m0/s1 |
| InChIKey | ASKGPBOJTJMOPH-HKSHTPPISA-N |
| XLogP | 7.01 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|