C23H16BrN3O3 — CID 71733646
3-(1-benzofuran-3-yl)-4-(6-bromo-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)pyrrole-2,5-dione (PubChem CID 71733646) has the molecular formula C23H16BrN3O3 and a molecular weight of 462.30 g/mol. Its IUPAC name is 3-(1-benzofuran-3-yl)-4-(6-bromo-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1-benzofuran-3-yl)-4-(6-bromo-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 71733646 |
| Molecular Formula | C23H16BrN3O3 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 3-(1-benzofuran-3-yl)-4-(6-bromo-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn3c4c(cc(Br)cc24)CNCC3)=C1c1coc2ccccc12 |
| InChI | InChI=1S/C23H16BrN3O3/c24-13-7-12-9-25-5-6-27-10-16(15(8-13)21(12)27)19-20(23(29)26-22(19)28)17-11-30-18-4-2-1-3-14(17)18/h1-4,7-8,10-11,25H,5-6,9H2,(H,26,28,29) |
| InChIKey | DMIAIRNHGRWXGV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|