C29H33N5O2 — CID 71733710
[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1,2,4-triazole-1-carboxylate (PubChem CID 71733710) has the molecular formula C29H33N5O2 and a molecular weight of 483.62 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1,2,4-triazole-1-carboxylate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1,2,4-triazole-1-carboxylate |
|---|---|
| PubChem CID | 71733710 |
| Molecular Formula | C29H33N5O2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1,2,4-triazole-1-carboxylate |
| SMILES | C[C@]12CC[C@H](OC(=O)n3cncn3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(n3cnc4ccccc43)=CC[C@@H]12 |
| InChI | InChI=1S/C29H33N5O2/c1-28-13-11-20(36-27(35)34-17-30-16-32-34)15-19(28)7-8-21-22-9-10-26(29(22,2)14-12-23(21)28)33-18-31-24-5-3-4-6-25(24)33/h3-7,10,16-18,20-23H,8-9,11-15H2,1-2H3/t20-,21-,22-,23-,28-,29-/m0/s1 |
| InChIKey | GIXXZKHGNJCPBI-QAKRQNAOSA-N |
| XLogP | 6.09 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|