About 3-propylphenanthro[9,10-c]pyridine
3-propylphenanthro[9,10-c]pyridine (PubChem CID 71733890) has the molecular formula C20H17N
and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-propylphenanthro[9,10-c]pyridine.
Molecular Properties
| Compound Name | 3-propylphenanthro[9,10-c]pyridine |
| PubChem CID | 71733890 |
| Molecular Formula | C20H17N |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-propylphenanthro[9,10-c]pyridine |
| SMILES | CCCc1cc2c3ccccc3c3ccccc3c2cn1 |
| InChI | InChI=1S/C20H17N/c1-2-7-14-12-19-17-10-5-3-8-15(17)16-9-4-6-11-18(16)20(19)13-21-14/h3-6,8-13H,2,7H2,1H3 |
| InChIKey | WHWCZKPCXIIDSJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-propylphenanthro[9,10-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propylphenanthro[9,10-c]pyridine?
The IUPAC name of 3-propylphenanthro[9,10-c]pyridine (CID 71733890) is 3-propylphenanthro[9,10-c]pyridine.
What is the SMILES notation for 3-propylphenanthro[9,10-c]pyridine?
The canonical SMILES for 3-propylphenanthro[9,10-c]pyridine is CCCc1cc2c3ccccc3c3ccccc3c2cn1.
What is the InChIKey of 3-propylphenanthro[9,10-c]pyridine?
The InChIKey is WHWCZKPCXIIDSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N/c1-2-7-14-12-19-17-10-5-3-8-15(17)16-9-4-6-11-18(16)20(19)13-21-14/h3-6,8-13H,2,7H2,1H3.
What are the key properties of 3-propylphenanthro[9,10-c]pyridine?
3-propylphenanthro[9,10-c]pyridine has a molecular weight of 271.36 g/mol, XLogP of 5.49, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propylphenanthro[9,10-c]pyridine is sourced from PubChem (CID 71733890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).