C13H17NO2 — CID 71733901
butyl (Z)-3-(2,3,4,5,6-pentadeuterioanilino)prop-2-enoate (PubChem CID 71733901) has the molecular formula C13H17NO2 and a molecular weight of 224.31 g/mol. Its IUPAC name is butyl (Z)-3-(2,3,4,5,6-pentadeuterioanilino)prop-2-enoate.
| Compound Name | butyl (Z)-3-(2,3,4,5,6-pentadeuterioanilino)prop-2-enoate |
|---|---|
| PubChem CID | 71733901 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | butyl (Z)-3-(2,3,4,5,6-pentadeuterioanilino)prop-2-enoate |
| SMILES | [2H]c1c([2H])c([2H])c(N/C=C\C(=O)OCCCC)c([2H])c1[2H] |
| InChI | InChI=1S/C13H17NO2/c1-2-3-11-16-13(15)9-10-14-12-7-5-4-6-8-12/h4-10,14H,2-3,11H2,1H3/b10-9-/i4D,5D,6D,7D,8D |
| InChIKey | JJSXKPUEPJPUSB-UGIHQWDESA-N |
| XLogP | 2.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|