C27H40N2O9S3 — CID 71733926
2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methyl-(2-sulfoethyl)amino]ethanesulfonic acid (PubChem CID 71733926) has the molecular formula C27H40N2O9S3 and a molecular weight of 632.82 g/mol. Its IUPAC name is 2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methyl-(2-sulfoethyl)amino]ethanesulfonic acid.
| Compound Name | 2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methyl-(2-sulfoethyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 71733926 |
| Molecular Formula | C27H40N2O9S3 |
| Molecular Weight | 632.82 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | 2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methyl-(2-sulfoethyl)amino]ethanesulfonic acid |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CN(CCS(=O)(=O)O)CCS(=O)(=O)O)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C27H40N2O9S3/c1-4-6-12-27(5-2)20-39(30,31)25-17-22(19-29(13-15-40(32,33)34)14-16-41(35,36)37)24(38-3)18-23(25)26(28-27)21-10-8-7-9-11-21/h7-11,17-18,26,28H,4-6,12-16,19-20H2,1-3H3,(H,32,33,34)(H,35,36,37)/t26-,27-/m1/s1 |
| InChIKey | WSKJEEVBUUOVRM-KAYWLYCHSA-N |
| XLogP | 3.08 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.82 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|