C23H31NO6S2 — CID 71734215
[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methanesulfonic acid (PubChem CID 71734215) has the molecular formula C23H31NO6S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is [(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methanesulfonic acid.
| Compound Name | [(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 71734215 |
| Molecular Formula | C23H31NO6S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | [(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methanesulfonic acid |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CS(=O)(=O)O)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C23H31NO6S2/c1-4-6-12-23(5-2)16-31(25,26)21-13-18(15-32(27,28)29)20(30-3)14-19(21)22(24-23)17-10-8-7-9-11-17/h7-11,13-14,22,24H,4-6,12,15-16H2,1-3H3,(H,27,28,29)/t22-,23-/m1/s1 |
| InChIKey | BFWPUQURSUWSSX-DHIUTWEWSA-N |
| XLogP | 3.89 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|