C8H13N4O3P — CID 71734417
[amino-[4-(diaminomethylideneamino)phenyl]methyl]phosphonic acid (PubChem CID 71734417) has the molecular formula C8H13N4O3P and a molecular weight of 244.19 g/mol. Its IUPAC name is [amino-[4-(diaminomethylideneamino)phenyl]methyl]phosphonic acid.
| Compound Name | [amino-[4-(diaminomethylideneamino)phenyl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 71734417 |
| Molecular Formula | C8H13N4O3P |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | [amino-[4-(diaminomethylideneamino)phenyl]methyl]phosphonic acid |
| SMILES | NC(N)=Nc1ccc(C(N)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C8H13N4O3P/c9-7(16(13,14)15)5-1-3-6(4-2-5)12-8(10)11/h1-4,7H,9H2,(H4,10,11,12)(H2,13,14,15) |
| InChIKey | BSLYPYFABFFNHY-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|